N-(2-phenylquinolin-3-yl)acetamide

Product Code: 998869
Molecular Formula: C17H14N2O
Molecular Weight: 262.31
5463-89-8
5464-10-8 1H-inden-1-one, 2,3-dihydro-6-methoxy-2-methyl-
5463-89-8 N-(2-phenylquinolin-3-yl)acetamide
54638-78-7 Benzenamine, 4-(5-[1,1'-biphenyl]-4-yl-2-oxazolyl)-N,N-dimethyl-
5463-85-4 5-butyl-5-ethyl-2-octyl-1,3-dioxane
5463-78-5 1-(2-nitrophenyl)butane-1,3-dione
54642-67-0 1(3H)-Isobenzofuranone,3-[4-(diethylamino)-2-ethoxyphenyl]-3-(1-ethyl-2-methyl-1H-indol-3-yl)-7-nitro-
54644-14-3 5-ETHOXY-2-PHENYLOXAZOLE-4-CARBONYL CHLORIDE
5464-16-4 2-aminocyclopentanone
5464-15-3 1-[ethyl(methyl)amino]propan-2-ol
54637-95-5 1,3-Butadiene, 1-(ethylthio)-, (E)-
54639-77-9 2,5-Methanopentalene, octahydro-3a,6a-dinitro-
5464-05-1 benzenesulfonamide, N-(2-chlorophenyl)-3-nitro-
5464-30-2 DL-Asparticacid, N-(2-cyanoethyl)-
546-40-7 (22S,25S)-5,6-Didehydro-5α-spirosolane-3β-ol
54638-75-4 Benzenamine,4-[4,5-dihydro-3-(4-methoxyphenyl)-5-phenyl-1H-pyrazol-1-yl]-
54643-10-6 1-PROPANONE,1-(PYRIMIDIN-4-YL)-
54637-78-4 3-Pentanol, 3-methyl-, potassium salt
5464-42-6 N-(2-carboxyethyl)-N-(phenylsulfonyl)alanine
54638-44-7 Pyridinium, 1-[2-amino-1-(aminocarbonyl)-1-methyl-2-oxoethyl]-,bromide
5463-82-1 3-Decanone, 2-methyl-