L-Phenylalanine, N-(3-chloro-1-oxopropyl)-
CAS No: 87579-26-8
Phenylalanine
87579-26-8
phenylalanine,chloro,oxopropyl,alanine,87579-26-8
2025-10-18 Discover L-Phenylalanine, N-(3-chloro-1-oxopropyl)- (CAS No: 87579-26-8) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.